C20H12Cl2KN6NaO7S2 — CID 170846467
potassium;sodium;2-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-oxido-3-sulfonaphthalen-2-yl]diazenyl]-5-methylbenzenesulfonate (PubChem CID 170846467) has the molecular formula C20H12Cl2KN6NaO7S2 and a molecular weight of 645.48 g/mol. Its IUPAC name is potassium;sodium;2-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-oxido-3-sulfonaphthalen-2-yl]diazenyl]-5-methylbenzenesulfonate.
| Compound Name | potassium;sodium;2-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-oxido-3-sulfonaphthalen-2-yl]diazenyl]-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 170846467 |
| Molecular Formula | C20H12Cl2KN6NaO7S2 |
| Molecular Weight | 645.48 g/mol |
| Exact Mass | 643.91 |
| IUPAC Name | potassium;sodium;2-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-oxido-3-sulfonaphthalen-2-yl]diazenyl]-5-methylbenzenesulfonate |
| SMILES | Cc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4nc(Cl)nc(Cl)n4)ccc3c2[O-])c(S(=O)(=O)[O-])c1.[K+].[Na+] |
| InChI | InChI=1S/C20H14Cl2N6O7S2.K.Na/c1-9-2-5-13(14(6-9)36(30,31)32)27-28-16-15(37(33,34)35)8-10-7-11(3-4-12(10)17(16)29)23-20-25-18(21)24-19(22)26-20;;/h2-8,29H,1H3,(H,30,31,32)(H,33,34,35)(H,23,24,25,26);;/q;2*+1/p-2/b28-27+;; |
| InChIKey | JCJMJOOVWVXMBR-JZYARHMISA-L |
| XLogP | -1.97 |
| TPSA | 210.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.48 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|