C31H29ClN8O8S2 — CID 136683298
7-[[4-chloro-6-[4-(diethylcarbamoyl)-2-methylanilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136683298) has the molecular formula C31H29ClN8O8S2 and a molecular weight of 741.21 g/mol. Its IUPAC name is 7-[[4-chloro-6-[4-(diethylcarbamoyl)-2-methylanilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-[[4-chloro-6-[4-(diethylcarbamoyl)-2-methylanilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136683298 |
| Molecular Formula | C31H29ClN8O8S2 |
| Molecular Weight | 741.21 g/mol |
| Exact Mass | 740.12 |
| IUPAC Name | 7-[[4-chloro-6-[4-(diethylcarbamoyl)-2-methylanilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CCN(CC)C(=O)c1ccc(Nc2nc(Cl)nc(Nc3ccc4c(O)c(/N=N/c5ccc(S(=O)(=O)O)cc5)c(S(=O)(=O)O)cc4c3)n2)c(C)c1 |
| InChI | InChI=1S/C31H29ClN8O8S2/c1-4-40(5-2)28(42)18-6-13-24(17(3)14-18)34-31-36-29(32)35-30(37-31)33-21-9-12-23-19(15-21)16-25(50(46,47)48)26(27(23)41)39-38-20-7-10-22(11-8-20)49(43,44)45/h6-16,41H,4-5H2,1-3H3,(H,43,44,45)(H,46,47,48)(H2,33,34,35,36,37)/b39-38+ |
| InChIKey | AVJRQKXZNUYUBT-YMZYAJTMSA-N |
| XLogP | 6.57 |
| TPSA | 236.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.21 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|