C27H22Cl3N9O4S — CID 135839761
4-[[4-chloro-6-[3-[[2-(2,5-dichloro-4-methylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-methylanilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 135839761) has the molecular formula C27H22Cl3N9O4S and a molecular weight of 674.96 g/mol. Its IUPAC name is 4-[[4-chloro-6-[3-[[2-(2,5-dichloro-4-methylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-methylanilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-chloro-6-[3-[[2-(2,5-dichloro-4-methylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-methylanilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 135839761 |
| Molecular Formula | C27H22Cl3N9O4S |
| Molecular Weight | 674.96 g/mol |
| Exact Mass | 673.06 |
| IUPAC Name | 4-[[4-chloro-6-[3-[[2-(2,5-dichloro-4-methylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-methylanilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Cc1cc(Cl)c(-n2[nH]c(C)c(/N=N/c3cc(Nc4nc(Cl)nc(Nc5ccc(S(=O)(=O)O)cc5)n4)ccc3C)c2=O)cc1Cl |
| InChI | InChI=1S/C27H22Cl3N9O4S/c1-13-4-5-17(32-27-34-25(30)33-26(35-27)31-16-6-8-18(9-7-16)44(41,42)43)11-21(13)36-37-23-15(3)38-39(24(23)40)22-12-19(28)14(2)10-20(22)29/h4-12,38H,1-3H3,(H,41,42,43)(H2,31,32,33,34,35)/b37-36+ |
| InChIKey | HEISGCXKGHSDLE-BSRQYYOTSA-N |
| XLogP | 7.39 |
| TPSA | 179.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.96 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|