C24H16Cl3N9O10S3 — CID 136845764
2,5-dichloro-4-[4-[[5-[[4-chloro-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid (PubChem CID 136845764) has the molecular formula C24H16Cl3N9O10S3 and a molecular weight of 793.00 g/mol. Its IUPAC name is 2,5-dichloro-4-[4-[[5-[[4-chloro-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid.
| Compound Name | 2,5-dichloro-4-[4-[[5-[[4-chloro-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136845764 |
| Molecular Formula | C24H16Cl3N9O10S3 |
| Molecular Weight | 793.00 g/mol |
| Exact Mass | 790.92 |
| IUPAC Name | 2,5-dichloro-4-[4-[[5-[[4-chloro-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
| SMILES | O=c1c(/N=N/c2cc(Nc3nc(Cl)nc(Nc4ccc(S(=O)(=O)O)cc4)n3)ccc2S(=O)(=O)O)c[nH]n1-c1cc(Cl)c(S(=O)(=O)O)cc1Cl |
| InChI | InChI=1S/C24H16Cl3N9O10S3/c25-14-9-20(49(44,45)46)15(26)8-18(14)36-21(37)17(10-28-36)35-34-16-7-12(3-6-19(16)48(41,42)43)30-24-32-22(27)31-23(33-24)29-11-1-4-13(5-2-11)47(38,39)40/h1-10,28H,(H,38,39,40)(H,41,42,43)(H,44,45,46)(H2,29,30,31,32,33)/b35-34+ |
| InChIKey | UFJYWMLUNWAUKK-XAHDOWKMSA-N |
| XLogP | 4.95 |
| TPSA | 288.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.00 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|