C18H17Cl2N7O8S2 — CID 136903509
4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid (PubChem CID 136903509) has the molecular formula C18H17Cl2N7O8S2 and a molecular weight of 594.42 g/mol. Its IUPAC name is 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136903509 |
| Molecular Formula | C18H17Cl2N7O8S2 |
| Molecular Weight | 594.42 g/mol |
| Exact Mass | 593.00 |
| IUPAC Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid |
| SMILES | CCn1c(O)c(CS(=O)(=O)O)c(C)c(/N=N/c2cc(Nc3nc(Cl)nc(Cl)n3)ccc2S(=O)(=O)O)c1=O |
| InChI | InChI=1S/C18H17Cl2N7O8S2/c1-3-27-14(28)10(7-36(30,31)32)8(2)13(15(27)29)26-25-11-6-9(4-5-12(11)37(33,34)35)21-18-23-16(19)22-17(20)24-18/h4-6,28H,3,7H2,1-2H3,(H,30,31,32)(H,33,34,35)(H,21,22,23,24)/b26-25+ |
| InChIKey | KVWUDENXKATHGY-OCEACIFDSA-N |
| XLogP | 3.17 |
| TPSA | 226.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|