C17H20N4O6S — CID 162055697
2-[(5-acetyl-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-4-(methylamino)benzenesulfonic acid (PubChem CID 162055697) has the molecular formula C17H20N4O6S and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[(5-acetyl-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-4-(methylamino)benzenesulfonic acid.
| Compound Name | 2-[(5-acetyl-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-4-(methylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 162055697 |
| Molecular Formula | C17H20N4O6S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[(5-acetyl-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-4-(methylamino)benzenesulfonic acid |
| SMILES | CCn1c(O)c(C(C)=O)c(C)c(/N=N/c2cc(NC)ccc2S(=O)(=O)O)c1=O |
| InChI | InChI=1S/C17H20N4O6S/c1-5-21-16(23)14(10(3)22)9(2)15(17(21)24)20-19-12-8-11(18-4)6-7-13(12)28(25,26)27/h6-8,18,23H,5H2,1-4H3,(H,25,26,27)/b20-19+ |
| InChIKey | NHYYSGXNTVOGSI-FMQUCBEESA-N |
| XLogP | 2.79 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|