C25H27ClN8O11S3 — CID 160754908
4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid;methane;sulfur trioxide (PubChem CID 160754908) has the molecular formula C25H27ClN8O11S3 and a molecular weight of 747.19 g/mol. Its IUPAC name is 4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid;methane;sulfur trioxide.
| Compound Name | 4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid;methane;sulfur trioxide |
|---|---|
| PubChem CID | 160754908 |
| Molecular Formula | C25H27ClN8O11S3 |
| Molecular Weight | 747.19 g/mol |
| Exact Mass | 746.06 |
| IUPAC Name | 4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid;methane;sulfur trioxide |
| SMILES | C.CCn1c(O)c(CS(=O)(=O)O)c(C)c(/N=N/c2cc(Nc3nc(Cl)nc(Nc4ccccc4)n3)ccc2S(=O)(=O)O)c1=O.O=S(=O)=O |
| InChI | InChI=1S/C24H23ClN8O8S2.CH4.O3S/c1-3-33-20(34)16(12-42(36,37)38)13(2)19(21(33)35)32-31-17-11-15(9-10-18(17)43(39,40)41)27-24-29-22(25)28-23(30-24)26-14-7-5-4-6-8-14;;1-4(2)3/h4-11,34H,3,12H2,1-2H3,(H,36,37,38)(H,39,40,41)(H2,26,27,28,29,30);1H4;/b32-31+;; |
| InChIKey | RKBSERHEEXKPGF-GLDAUVFXSA-N |
| XLogP | 3.89 |
| TPSA | 289.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|