C26H22ClF2N7Na2O9S2 — CID 170841410
CID 170841410 (PubChem CID 170841410) has the molecular formula C26H22ClF2N7Na2O9S2 and a molecular weight of 760.06 g/mol.
| Compound Name | CID 170841410 |
|---|---|
| PubChem CID | 170841410 |
| Molecular Formula | C26H22ClF2N7Na2O9S2 |
| Molecular Weight | 760.06 g/mol |
| Exact Mass | 759.04 |
| IUPAC Name | — |
| SMILES | CCn1c(O)c(CS(=O)(=O)O)c(C)c(/N=N/c2cc(NC(=O)c3ccc(Nc4nc(F)nc(F)c4Cl)cc3)ccc2S(=O)(=O)O)c1=O.[Na].[Na] |
| InChI | InChI=1S/C26H22ClF2N7O9S2.2Na/c1-3-36-24(38)16(11-46(40,41)42)12(2)20(25(36)39)35-34-17-10-15(8-9-18(17)47(43,44)45)31-23(37)13-4-6-14(7-5-13)30-22-19(27)21(28)32-26(29)33-22;;/h4-10,38H,3,11H2,1-2H3,(H,31,37)(H,30,32,33)(H,40,41,42)(H,43,44,45);;/b35-34+;; |
| InChIKey | VNVIXGSHBRKQHQ-KGNAMTJXSA-N |
| XLogP | 3.89 |
| TPSA | 242.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.06 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|