C25H15Cl2N7O10S2 — CID 136715731
4-[[5-[(2,3-dichloroquinoxaline-6-carbonyl)amino]-2-sulfophenyl]diazenyl]-3-oxo-2-(4-sulfophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 136715731) has the molecular formula C25H15Cl2N7O10S2 and a molecular weight of 708.47 g/mol. Its IUPAC name is 4-[[5-[(2,3-dichloroquinoxaline-6-carbonyl)amino]-2-sulfophenyl]diazenyl]-3-oxo-2-(4-sulfophenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-[[5-[(2,3-dichloroquinoxaline-6-carbonyl)amino]-2-sulfophenyl]diazenyl]-3-oxo-2-(4-sulfophenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136715731 |
| Molecular Formula | C25H15Cl2N7O10S2 |
| Molecular Weight | 708.47 g/mol |
| Exact Mass | 706.97 |
| IUPAC Name | 4-[[5-[(2,3-dichloroquinoxaline-6-carbonyl)amino]-2-sulfophenyl]diazenyl]-3-oxo-2-(4-sulfophenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)O)c(/N=N/c2c(C(=O)O)[nH]n(-c3ccc(S(=O)(=O)O)cc3)c2=O)c1)c1ccc2nc(Cl)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H15Cl2N7O10S2/c26-21-22(27)30-16-9-11(1-7-15(16)29-21)23(35)28-12-2-8-18(46(42,43)44)17(10-12)31-32-19-20(25(37)38)33-34(24(19)36)13-3-5-14(6-4-13)45(39,40)41/h1-10,33H,(H,28,35)(H,37,38)(H,39,40,41)(H,42,43,44)/b32-31+ |
| InChIKey | JWNARBGNGZCAFB-QNEJGDQOSA-N |
| XLogP | 4.27 |
| TPSA | 263.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|