C17H13ClN4O9S2 — CID 135783339
4-chloro-2-[[5-methyl-3-oxo-2-(4-sulfophenyl)-1H-pyrazol-4-yl]diazenyl]-6-sulfobenzoic acid (PubChem CID 135783339) has the molecular formula C17H13ClN4O9S2 and a molecular weight of 516.90 g/mol. Its IUPAC name is 4-chloro-2-[[5-methyl-3-oxo-2-(4-sulfophenyl)-1H-pyrazol-4-yl]diazenyl]-6-sulfobenzoic acid.
| Compound Name | 4-chloro-2-[[5-methyl-3-oxo-2-(4-sulfophenyl)-1H-pyrazol-4-yl]diazenyl]-6-sulfobenzoic acid |
|---|---|
| PubChem CID | 135783339 |
| Molecular Formula | C17H13ClN4O9S2 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 4-chloro-2-[[5-methyl-3-oxo-2-(4-sulfophenyl)-1H-pyrazol-4-yl]diazenyl]-6-sulfobenzoic acid |
| SMILES | Cc1[nH]n(-c2ccc(S(=O)(=O)O)cc2)c(=O)c1/N=N/c1cc(Cl)cc(S(=O)(=O)O)c1C(=O)O |
| InChI | InChI=1S/C17H13ClN4O9S2/c1-8-15(16(23)22(21-8)10-2-4-11(5-3-10)32(26,27)28)20-19-12-6-9(18)7-13(33(29,30)31)14(12)17(24)25/h2-7,21H,1H3,(H,24,25)(H,26,27,28)(H,29,30,31)/b20-19+ |
| InChIKey | ZLOLERZFJFWLBQ-FMQUCBEESA-N |
| XLogP | 2.73 |
| TPSA | 208.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|