C20H22N4O10S3 — CID 135790034
4-[4-[[2-methoxy-5-methyl-4-(2-sulfoethylsulfonyl)phenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid (PubChem CID 135790034) has the molecular formula C20H22N4O10S3 and a molecular weight of 574.62 g/mol. Its IUPAC name is 4-[4-[[2-methoxy-5-methyl-4-(2-sulfoethylsulfonyl)phenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid.
| Compound Name | 4-[4-[[2-methoxy-5-methyl-4-(2-sulfoethylsulfonyl)phenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135790034 |
| Molecular Formula | C20H22N4O10S3 |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | 4-[4-[[2-methoxy-5-methyl-4-(2-sulfoethylsulfonyl)phenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
| SMILES | COc1cc(S(=O)(=O)CCS(=O)(=O)O)c(C)cc1/N=N/c1c(C)[nH]n(-c2ccc(S(=O)(=O)O)cc2)c1=O |
| InChI | InChI=1S/C20H22N4O10S3/c1-12-10-16(17(34-3)11-18(12)35(26,27)8-9-36(28,29)30)21-22-19-13(2)23-24(20(19)25)14-4-6-15(7-5-14)37(31,32)33/h4-7,10-11,23H,8-9H2,1-3H3,(H,28,29,30)(H,31,32,33)/b22-21+ |
| InChIKey | KJADCRBWFNTPPI-QURGRASLSA-N |
| XLogP | 2.11 |
| TPSA | 214.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|