C16H14N4O7S2 — CID 135564870
4-[[5-methyl-3-oxo-2-(4-sulfophenyl)-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid (PubChem CID 135564870) has the molecular formula C16H14N4O7S2 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-[[5-methyl-3-oxo-2-(4-sulfophenyl)-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[5-methyl-3-oxo-2-(4-sulfophenyl)-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135564870 |
| Molecular Formula | C16H14N4O7S2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 4-[[5-methyl-3-oxo-2-(4-sulfophenyl)-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1[nH]n(-c2ccc(S(=O)(=O)O)cc2)c(=O)c1/N=N/c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H14N4O7S2/c1-10-15(18-17-11-2-6-13(7-3-11)28(22,23)24)16(21)20(19-10)12-4-8-14(9-5-12)29(25,26)27/h2-9,19H,1H3,(H,22,23,24)(H,25,26,27)/b18-17+ |
| InChIKey | NPPOMUXYYMMPSB-ISLYRVAYSA-N |
| XLogP | 2.38 |
| TPSA | 171.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|