C23H19N4NaO7S2 — CID 135564885
sodium 4-[5-methyl-4-[[4-(4-methylphenyl)sulfonyloxyphenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonate (PubChem CID 135564885) has the molecular formula C23H19N4NaO7S2 and a molecular weight of 550.55 g/mol. Its IUPAC name is sodium 4-[5-methyl-4-[[4-(4-methylphenyl)sulfonyloxyphenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonate.
| Compound Name | sodium 4-[5-methyl-4-[[4-(4-methylphenyl)sulfonyloxyphenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 135564885 |
| Molecular Formula | C23H19N4NaO7S2 |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | sodium 4-[5-methyl-4-[[4-(4-methylphenyl)sulfonyloxyphenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/N=N/c3c(C)[nH]n(-c4ccc(S(=O)(=O)[O-])cc4)c3=O)cc2)cc1.[Na+] |
| InChI | InChI=1S/C23H20N4O7S2.Na/c1-15-3-11-21(12-4-15)36(32,33)34-19-9-5-17(6-10-19)24-25-22-16(2)26-27(23(22)28)18-7-13-20(14-8-18)35(29,30)31;/h3-14,26H,1-2H3,(H,29,30,31);/q;+1/p-1/b25-24+; |
| InChIKey | QZDJOVBYLCCCBJ-QREUMGABSA-M |
| XLogP | 0.87 |
| TPSA | 163.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|