C20H16N8O5S — CID 136857488
4-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 136857488) has the molecular formula C20H16N8O5S and a molecular weight of 480.47 g/mol. Its IUPAC name is 4-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 4-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 136857488 |
| Molecular Formula | C20H16N8O5S |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 4-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | Cc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1/N=N/c1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C20H16N8O5S/c1-13-18(19(29)27(25-13)15-5-7-16(8-6-15)28(30)31)24-23-14-3-9-17(10-4-14)34(32,33)26-20-21-11-2-12-22-20/h2-12,25H,1H3,(H,21,22,26)/b24-23+ |
| InChIKey | PVBQYXZJORENOA-WCWDXBQESA-N |
| XLogP | 3.39 |
| TPSA | 177.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|