C23H21N7O5S — CID 135717863
4-[1-[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-N-(4-methylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 135717863) has the molecular formula C23H21N7O5S and a molecular weight of 507.53 g/mol. Its IUPAC name is 4-[1-[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-N-(4-methylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-[1-[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-N-(4-methylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135717863 |
| Molecular Formula | C23H21N7O5S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 4-[1-[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-N-(4-methylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | C/C(=N\c1ccc(S(=O)(=O)Nc2nccc(C)n2)cc1)c1c(C)[nH]n(-c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C23H21N7O5S/c1-14-12-13-24-23(25-14)28-36(34,35)20-10-4-17(5-11-20)26-15(2)21-16(3)27-29(22(21)31)18-6-8-19(9-7-18)30(32)33/h4-13,27H,1-3H3,(H,24,25,28)/b26-15+ |
| InChIKey | MLOMWFZQAWBITG-CVKSISIWSA-N |
| XLogP | 3.42 |
| TPSA | 165.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|