C21H19N7O3 — CID 135727606
5-methyl-4-[C-methyl-N-[4-(1,2,4-triazol-4-ylmethyl)phenyl]carbonimidoyl]-2-(4-nitrophenyl)-1H-pyrazol-3-one (PubChem CID 135727606) has the molecular formula C21H19N7O3 and a molecular weight of 417.43 g/mol. Its IUPAC name is 5-methyl-4-[C-methyl-N-[4-(1,2,4-triazol-4-ylmethyl)phenyl]carbonimidoyl]-2-(4-nitrophenyl)-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-[C-methyl-N-[4-(1,2,4-triazol-4-ylmethyl)phenyl]carbonimidoyl]-2-(4-nitrophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135727606 |
| Molecular Formula | C21H19N7O3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 5-methyl-4-[C-methyl-N-[4-(1,2,4-triazol-4-ylmethyl)phenyl]carbonimidoyl]-2-(4-nitrophenyl)-1H-pyrazol-3-one |
| SMILES | C/C(=N\c1ccc(Cn2cnnc2)cc1)c1c(C)[nH]n(-c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C21H19N7O3/c1-14(24-17-5-3-16(4-6-17)11-26-12-22-23-13-26)20-15(2)25-27(21(20)29)18-7-9-19(10-8-18)28(30)31/h3-10,12-13,25H,11H2,1-2H3/b24-14+ |
| InChIKey | BNFAARPCUTVYFK-ZVHZXABRSA-N |
| XLogP | 3.16 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|