C27H26N4O3 — CID 135727532
4-[N-(3,3-diphenylpropyl)-C-methylcarbonimidoyl]-5-methyl-2-(4-nitrophenyl)-1H-pyrazol-3-one (PubChem CID 135727532) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-[N-(3,3-diphenylpropyl)-C-methylcarbonimidoyl]-5-methyl-2-(4-nitrophenyl)-1H-pyrazol-3-one.
| Compound Name | 4-[N-(3,3-diphenylpropyl)-C-methylcarbonimidoyl]-5-methyl-2-(4-nitrophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135727532 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 4-[N-(3,3-diphenylpropyl)-C-methylcarbonimidoyl]-5-methyl-2-(4-nitrophenyl)-1H-pyrazol-3-one |
| SMILES | C/C(=N\CCC(c1ccccc1)c1ccccc1)c1c(C)[nH]n(-c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C27H26N4O3/c1-19(26-20(2)29-30(27(26)32)23-13-15-24(16-14-23)31(33)34)28-18-17-25(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16,25,29H,17-18H2,1-2H3/b28-19+ |
| InChIKey | ZZZQDMHEFBBEGM-TURZUDJPSA-N |
| XLogP | 5.41 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|