C19H18FN3O — CID 135727485
4-(N-benzyl-C-methylcarbonimidoyl)-2-(4-fluorophenyl)-5-methyl-1H-pyrazol-3-one (PubChem CID 135727485) has the molecular formula C19H18FN3O and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-(N-benzyl-C-methylcarbonimidoyl)-2-(4-fluorophenyl)-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-(N-benzyl-C-methylcarbonimidoyl)-2-(4-fluorophenyl)-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135727485 |
| Molecular Formula | C19H18FN3O |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-(N-benzyl-C-methylcarbonimidoyl)-2-(4-fluorophenyl)-5-methyl-1H-pyrazol-3-one |
| SMILES | C/C(=N\Cc1ccccc1)c1c(C)[nH]n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C19H18FN3O/c1-13(21-12-15-6-4-3-5-7-15)18-14(2)22-23(19(18)24)17-10-8-16(20)9-11-17/h3-11,22H,12H2,1-2H3/b21-13+ |
| InChIKey | PTXXBYLXRLZGCM-FYJGNVAPSA-N |
| XLogP | 3.62 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|