C22H24FN3O — CID 135728393
2-(4-fluorophenyl)-4-(C-methyl-N-pentylcarbonimidoyl)-5-phenyl-1H-pyrazol-3-one (PubChem CID 135728393) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(C-methyl-N-pentylcarbonimidoyl)-5-phenyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-fluorophenyl)-4-(C-methyl-N-pentylcarbonimidoyl)-5-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135728393 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(C-methyl-N-pentylcarbonimidoyl)-5-phenyl-1H-pyrazol-3-one |
| SMILES | CCCCC/N=C(\C)c1c(-c2ccccc2)[nH]n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C22H24FN3O/c1-3-4-8-15-24-16(2)20-21(17-9-6-5-7-10-17)25-26(22(20)27)19-13-11-18(23)12-14-19/h5-7,9-14,25H,3-4,8,15H2,1-2H3/b24-16+ |
| InChIKey | CVYZQPRISJTTPQ-LFVJCYFKSA-N |
| XLogP | 4.97 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|