C25H23N3O2 — CID 135624722
4-[N-[(2-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one (PubChem CID 135624722) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-[N-[(2-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one.
| Compound Name | 4-[N-[(2-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135624722 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-[N-[(2-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one |
| SMILES | COc1ccccc1C/N=C(\C)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C25H23N3O2/c1-18(26-17-20-13-9-10-16-22(20)30-2)23-24(19-11-5-3-6-12-19)27-28(25(23)29)21-14-7-4-8-15-21/h3-16,27H,17H2,1-2H3/b26-18+ |
| InChIKey | SWVZCTSZHIZIOG-NLRVBDNBSA-N |
| XLogP | 4.85 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|