C16H11N2O3- — CID 2384840
3-oxo-2,5-diphenyl-1H-pyrazole-4-carboxylate (PubChem CID 2384840) has the molecular formula C16H11N2O3- and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-oxo-2,5-diphenyl-1H-pyrazole-4-carboxylate.
| Compound Name | 3-oxo-2,5-diphenyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2384840 |
| Molecular Formula | C16H11N2O3- |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-oxo-2,5-diphenyl-1H-pyrazole-4-carboxylate |
| SMILES | O=C([O-])c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C16H12N2O3/c19-15-13(16(20)21)14(11-7-3-1-4-8-11)17-18(15)12-9-5-2-6-10-12/h1-10,17H,(H,20,21)/p-1 |
| InChIKey | KFVXTMXGYABNAE-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |