C29H23N3O — CID 135728590
4-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one (PubChem CID 135728590) has the molecular formula C29H23N3O and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one.
| Compound Name | 4-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135728590 |
| Molecular Formula | C29H23N3O |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 4-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one |
| SMILES | C/C(=N\c1ccccc1-c1ccccc1)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C29H23N3O/c1-21(30-26-20-12-11-19-25(26)22-13-5-2-6-14-22)27-28(23-15-7-3-8-16-23)31-32(29(27)33)24-17-9-4-10-18-24/h2-20,31H,1H3/b30-21+ |
| InChIKey | QNVBKUDLGRXGTE-MWAVMZGNSA-N |
| XLogP | 6.64 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|