C23H18FN3O — CID 135728568
4-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one (PubChem CID 135728568) has the molecular formula C23H18FN3O and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one.
| Compound Name | 4-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135728568 |
| Molecular Formula | C23H18FN3O |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one |
| SMILES | C/C(=N\c1ccc(F)cc1)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H18FN3O/c1-16(25-19-14-12-18(24)13-15-19)21-22(17-8-4-2-5-9-17)26-27(23(21)28)20-10-6-3-7-11-20/h2-15,26H,1H3/b25-16+ |
| InChIKey | QZZOQPWUFYSJMT-PCLIKHOPSA-N |
| XLogP | 5.11 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|