C25H20N4O5 — CID 135687576
methyl 4-[1-[2-(4-nitrophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]benzoate (PubChem CID 135687576) has the molecular formula C25H20N4O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is methyl 4-[1-[2-(4-nitrophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]benzoate.
| Compound Name | methyl 4-[1-[2-(4-nitrophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]benzoate |
|---|---|
| PubChem CID | 135687576 |
| Molecular Formula | C25H20N4O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | methyl 4-[1-[2-(4-nitrophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C(\C)c2c(-c3ccccc3)[nH]n(-c3ccc([N+](=O)[O-])cc3)c2=O)cc1 |
| InChI | InChI=1S/C25H20N4O5/c1-16(26-19-10-8-18(9-11-19)25(31)34-2)22-23(17-6-4-3-5-7-17)27-28(24(22)30)20-12-14-21(15-13-20)29(32)33/h3-15,27H,1-2H3/b26-16+ |
| InChIKey | HKDSHXPDSPOHTC-WGOQTCKBSA-N |
| XLogP | 4.67 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|