C28H24N4O8 — CID 135728905
dimethyl 2-[1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzene-1,4-dicarboxylate (PubChem CID 135728905) has the molecular formula C28H24N4O8 and a molecular weight of 544.52 g/mol. Its IUPAC name is dimethyl 2-[1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 135728905 |
| Molecular Formula | C28H24N4O8 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | dimethyl 2-[1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(/N=C(\C)c2c(-c3ccc(OC)cc3)[nH]n(-c3ccc([N+](=O)[O-])cc3)c2=O)c1 |
| InChI | InChI=1S/C28H24N4O8/c1-16(29-23-15-18(27(34)39-3)7-14-22(23)28(35)40-4)24-25(17-5-12-21(38-2)13-6-17)30-31(26(24)33)19-8-10-20(11-9-19)32(36)37/h5-15,30H,1-4H3/b29-16+ |
| InChIKey | ZFLHOGUZYHKBAV-MUFRIFMGSA-N |
| XLogP | 4.46 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|