C23H19N5O4 — CID 137025198
5-(4-methoxyphenyl)-4-(C-methyl-N-pyridin-2-ylcarbonimidoyl)-2-(4-nitrophenyl)-1H-pyrazol-3-one (PubChem CID 137025198) has the molecular formula C23H19N5O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-(C-methyl-N-pyridin-2-ylcarbonimidoyl)-2-(4-nitrophenyl)-1H-pyrazol-3-one.
| Compound Name | 5-(4-methoxyphenyl)-4-(C-methyl-N-pyridin-2-ylcarbonimidoyl)-2-(4-nitrophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137025198 |
| Molecular Formula | C23H19N5O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-(C-methyl-N-pyridin-2-ylcarbonimidoyl)-2-(4-nitrophenyl)-1H-pyrazol-3-one |
| SMILES | COc1ccc(-c2[nH]n(-c3ccc([N+](=O)[O-])cc3)c(=O)c2C(C)=Nc2ccccn2)cc1 |
| InChI | InChI=1S/C23H19N5O4/c1-15(25-20-5-3-4-14-24-20)21-22(16-6-12-19(32-2)13-7-16)26-27(23(21)29)17-8-10-18(11-9-17)28(30)31/h3-14,26H,1-2H3 |
| InChIKey | LIQNHDNXUXZBJT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|