C28H26N4O8 — CID 135728909
methyl 4,5-dimethoxy-2-[1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzoate (PubChem CID 135728909) has the molecular formula C28H26N4O8 and a molecular weight of 546.54 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzoate |
|---|---|
| PubChem CID | 135728909 |
| Molecular Formula | C28H26N4O8 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1/N=C(\C)c1c(-c2ccc(OC)cc2)[nH]n(-c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C28H26N4O8/c1-16(29-22-15-24(39-4)23(38-3)14-21(22)28(34)40-5)25-26(17-6-12-20(37-2)13-7-17)30-31(27(25)33)18-8-10-19(11-9-18)32(35)36/h6-15,30H,1-5H3/b29-16+ |
| InChIKey | MWTHFOTUNPNQOO-MUFRIFMGSA-N |
| XLogP | 4.69 |
| TPSA | 147.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|