C23H25N5O5 — CID 135728787
N-[(E)-1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide (PubChem CID 135728787) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is N-[(E)-1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide.
| Compound Name | N-[(E)-1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 135728787 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[(E)-1-[5-(4-methoxyphenyl)-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide |
| SMILES | COc1ccc(-c2[nH]n(-c3ccc([N+](=O)[O-])cc3)c(=O)c2/C(C)=N/NC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C23H25N5O5/c1-14(2)13-20(29)25-24-15(3)21-22(16-5-11-19(33-4)12-6-16)26-27(23(21)30)17-7-9-18(10-8-17)28(31)32/h5-12,14,26H,13H2,1-4H3,(H,25,29)/b24-15+ |
| InChIKey | OAMAFFVPEGINIB-BUVRLJJBSA-N |
| XLogP | 3.64 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|