C23H26N4O3 — CID 137157750
N-[1-[2-(4-methoxyphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide (PubChem CID 137157750) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[1-[2-(4-methoxyphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide.
| Compound Name | N-[1-[2-(4-methoxyphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 137157750 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[1-[2-(4-methoxyphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide |
| SMILES | COc1ccc(-n2[nH]c(-c3ccccc3)c(C(C)=NNC(=O)CC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C23H26N4O3/c1-15(2)14-20(28)25-24-16(3)21-22(17-8-6-5-7-9-17)26-27(23(21)29)18-10-12-19(30-4)13-11-18/h5-13,15,26H,14H2,1-4H3,(H,25,28) |
| InChIKey | NHBDASOUEBZWQR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|