C24H20FN5O3 — CID 137157399
N-[1-[2-(4-fluorophenyl)-5-(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]pyridine-4-carboxamide (PubChem CID 137157399) has the molecular formula C24H20FN5O3 and a molecular weight of 445.45 g/mol. Its IUPAC name is N-[1-[2-(4-fluorophenyl)-5-(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[1-[2-(4-fluorophenyl)-5-(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 137157399 |
| Molecular Formula | C24H20FN5O3 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[1-[2-(4-fluorophenyl)-5-(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]pyridine-4-carboxamide |
| SMILES | COc1ccc(-c2[nH]n(-c3ccc(F)cc3)c(=O)c2C(C)=NNC(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C24H20FN5O3/c1-15(27-28-23(31)17-11-13-26-14-12-17)21-22(16-3-9-20(33-2)10-4-16)29-30(24(21)32)19-7-5-18(25)6-8-19/h3-14,29H,1-2H3,(H,28,31) |
| InChIKey | GGSACUQZMQKSPX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|