C29H30N4O7 — CID 135728773
N-[(E)-1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 135728773) has the molecular formula C29H30N4O7 and a molecular weight of 546.58 g/mol. Its IUPAC name is N-[(E)-1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(E)-1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 135728773 |
| Molecular Formula | C29H30N4O7 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N-[(E)-1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(-c2[nH]n(-c3ccc(OC)cc3)c(=O)c2/C(C)=N/NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H30N4O7/c1-17(30-31-28(34)19-15-23(38-4)27(40-6)24(16-19)39-5)25-26(18-7-11-21(36-2)12-8-18)32-33(29(25)35)20-9-13-22(37-3)14-10-20/h7-16,32H,1-6H3,(H,31,34)/b30-17+ |
| InChIKey | PCLDHWDCSFZAGR-OCSSWDANSA-N |
| XLogP | 4.03 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|