C24H22N4O4S — CID 137078036
N-[1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]thiophene-2-carboxamide (PubChem CID 137078036) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 137078036 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2[nH]n(-c3ccc(OC)cc3)c(=O)c2C(C)=NNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H22N4O4S/c1-15(25-26-23(29)20-5-4-14-33-20)21-22(16-6-10-18(31-2)11-7-16)27-28(24(21)30)17-8-12-19(32-3)13-9-17/h4-14,27H,1-3H3,(H,26,29) |
| InChIKey | CXPMLVNYOHXZTE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|