C19H17N5O6S — CID 137090469
methyl 2-[4-[C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate (PubChem CID 137090469) has the molecular formula C19H17N5O6S and a molecular weight of 443.44 g/mol. Its IUPAC name is methyl 2-[4-[C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate.
| Compound Name | methyl 2-[4-[C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 137090469 |
| Molecular Formula | C19H17N5O6S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | methyl 2-[4-[C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
| SMILES | COC(=O)Cc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1C(C)=NNC(=O)c1cccs1 |
| InChI | InChI=1S/C19H17N5O6S/c1-11(20-21-18(26)15-4-3-9-31-15)17-14(10-16(25)30-2)22-23(19(17)27)12-5-7-13(8-6-12)24(28)29/h3-9,22H,10H2,1-2H3,(H,21,26) |
| InChIKey | DHNWWKFRROOHLN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|