C27H31N5O9 — CID 137025173
methyl 2-[4-[C-methyl-N-[(3,4,5-triethoxybenzoyl)amino]carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate (PubChem CID 137025173) has the molecular formula C27H31N5O9 and a molecular weight of 569.57 g/mol. Its IUPAC name is methyl 2-[4-[C-methyl-N-[(3,4,5-triethoxybenzoyl)amino]carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate.
| Compound Name | methyl 2-[4-[C-methyl-N-[(3,4,5-triethoxybenzoyl)amino]carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 137025173 |
| Molecular Formula | C27H31N5O9 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | methyl 2-[4-[C-methyl-N-[(3,4,5-triethoxybenzoyl)amino]carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
| SMILES | CCOc1cc(C(=O)NN=C(C)c2c(CC(=O)OC)[nH]n(-c3ccc([N+](=O)[O-])cc3)c2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H31N5O9/c1-6-39-21-13-17(14-22(40-7-2)25(21)41-8-3)26(34)29-28-16(4)24-20(15-23(33)38-5)30-31(27(24)35)18-9-11-19(12-10-18)32(36)37/h9-14,30H,6-8,15H2,1-5H3,(H,29,34) |
| InChIKey | GNIVDFQHETUIBH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|