C20H16Cl2N4O5 — CID 135687695
methyl 2-[4-[N-(2,4-dichlorophenyl)-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate (PubChem CID 135687695) has the molecular formula C20H16Cl2N4O5 and a molecular weight of 463.28 g/mol. Its IUPAC name is methyl 2-[4-[N-(2,4-dichlorophenyl)-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate.
| Compound Name | methyl 2-[4-[N-(2,4-dichlorophenyl)-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 135687695 |
| Molecular Formula | C20H16Cl2N4O5 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | methyl 2-[4-[N-(2,4-dichlorophenyl)-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
| SMILES | COC(=O)Cc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1/C(C)=N/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N4O5/c1-11(23-16-8-3-12(21)9-15(16)22)19-17(10-18(27)31-2)24-25(20(19)28)13-4-6-14(7-5-13)26(29)30/h3-9,24H,10H2,1-2H3/b23-11+ |
| InChIKey | WRXXNANDCURBOT-FOKLQQMPSA-N |
| XLogP | 4.24 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|