C19H23N5O6 — CID 137090271
methyl 2-[4-[C-methyl-N-(3-methylbutanoylamino)carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate (PubChem CID 137090271) has the molecular formula C19H23N5O6 and a molecular weight of 417.42 g/mol. Its IUPAC name is methyl 2-[4-[C-methyl-N-(3-methylbutanoylamino)carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate.
| Compound Name | methyl 2-[4-[C-methyl-N-(3-methylbutanoylamino)carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 137090271 |
| Molecular Formula | C19H23N5O6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | methyl 2-[4-[C-methyl-N-(3-methylbutanoylamino)carbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
| SMILES | COC(=O)Cc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1C(C)=NNC(=O)CC(C)C |
| InChI | InChI=1S/C19H23N5O6/c1-11(2)9-16(25)21-20-12(3)18-15(10-17(26)30-4)22-23(19(18)27)13-5-7-14(8-6-13)24(28)29/h5-8,11,22H,9-10H2,1-4H3,(H,21,25) |
| InChIKey | BRUJAWUVJVSUKJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|