C28H26N4O4 — CID 137078003
methyl 2-[4-[N-[(2,2-diphenylacetyl)amino]-C-methylcarbonimidoyl]-3-oxo-2-phenyl-1H-pyrazol-5-yl]acetate (PubChem CID 137078003) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is methyl 2-[4-[N-[(2,2-diphenylacetyl)amino]-C-methylcarbonimidoyl]-3-oxo-2-phenyl-1H-pyrazol-5-yl]acetate.
| Compound Name | methyl 2-[4-[N-[(2,2-diphenylacetyl)amino]-C-methylcarbonimidoyl]-3-oxo-2-phenyl-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 137078003 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | methyl 2-[4-[N-[(2,2-diphenylacetyl)amino]-C-methylcarbonimidoyl]-3-oxo-2-phenyl-1H-pyrazol-5-yl]acetate |
| SMILES | COC(=O)Cc1[nH]n(-c2ccccc2)c(=O)c1C(C)=NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N4O4/c1-19(25-23(18-24(33)36-2)31-32(28(25)35)22-16-10-5-11-17-22)29-30-27(34)26(20-12-6-3-7-13-20)21-14-8-4-9-15-21/h3-17,26,31H,18H2,1-2H3,(H,30,34) |
| InChIKey | AECNGTMMPLWQLK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|