C26H23N3O3 — CID 135728288
methyl 2-[4-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-3-oxo-2-phenyl-1H-pyrazol-5-yl]acetate (PubChem CID 135728288) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is methyl 2-[4-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-3-oxo-2-phenyl-1H-pyrazol-5-yl]acetate.
| Compound Name | methyl 2-[4-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-3-oxo-2-phenyl-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 135728288 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | methyl 2-[4-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-3-oxo-2-phenyl-1H-pyrazol-5-yl]acetate |
| SMILES | COC(=O)Cc1[nH]n(-c2ccccc2)c(=O)c1/C(C)=N/c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H23N3O3/c1-18(27-22-16-10-9-15-21(22)19-11-5-3-6-12-19)25-23(17-24(30)32-2)28-29(26(25)31)20-13-7-4-8-14-20/h3-16,28H,17H2,1-2H3/b27-18+ |
| InChIKey | NORGRHKYJCBJDQ-OVVQPSECSA-N |
| XLogP | 4.69 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|