C22H21ClN4O7 — CID 135717706
methyl 2-[4-[N-(4-chloro-2,5-dimethoxyphenyl)-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate (PubChem CID 135717706) has the molecular formula C22H21ClN4O7 and a molecular weight of 488.88 g/mol. Its IUPAC name is methyl 2-[4-[N-(4-chloro-2,5-dimethoxyphenyl)-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate.
| Compound Name | methyl 2-[4-[N-(4-chloro-2,5-dimethoxyphenyl)-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 135717706 |
| Molecular Formula | C22H21ClN4O7 |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | methyl 2-[4-[N-(4-chloro-2,5-dimethoxyphenyl)-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
| SMILES | COC(=O)Cc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1/C(C)=N/c1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C22H21ClN4O7/c1-12(24-16-10-18(32-2)15(23)9-19(16)33-3)21-17(11-20(28)34-4)25-26(22(21)29)13-5-7-14(8-6-13)27(30)31/h5-10,25H,11H2,1-4H3/b24-12+ |
| InChIKey | BYGZZEOVCXTSAN-WYMPLXKRSA-N |
| XLogP | 3.60 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|