C27H31FN4O7 — CID 137025172
methyl 2-[2-(4-fluorophenyl)-4-[C-methyl-N-[(3,4,5-triethoxybenzoyl)amino]carbonimidoyl]-3-oxo-1H-pyrazol-5-yl]acetate (PubChem CID 137025172) has the molecular formula C27H31FN4O7 and a molecular weight of 542.56 g/mol. Its IUPAC name is methyl 2-[2-(4-fluorophenyl)-4-[C-methyl-N-[(3,4,5-triethoxybenzoyl)amino]carbonimidoyl]-3-oxo-1H-pyrazol-5-yl]acetate.
| Compound Name | methyl 2-[2-(4-fluorophenyl)-4-[C-methyl-N-[(3,4,5-triethoxybenzoyl)amino]carbonimidoyl]-3-oxo-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 137025172 |
| Molecular Formula | C27H31FN4O7 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | methyl 2-[2-(4-fluorophenyl)-4-[C-methyl-N-[(3,4,5-triethoxybenzoyl)amino]carbonimidoyl]-3-oxo-1H-pyrazol-5-yl]acetate |
| SMILES | CCOc1cc(C(=O)NN=C(C)c2c(CC(=O)OC)[nH]n(-c3ccc(F)cc3)c2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H31FN4O7/c1-6-37-21-13-17(14-22(38-7-2)25(21)39-8-3)26(34)30-29-16(4)24-20(15-23(33)36-5)31-32(27(24)35)19-11-9-18(28)10-12-19/h9-14,31H,6-8,15H2,1-5H3,(H,30,34) |
| InChIKey | PVGKVDBSWBOVMW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|