C19H20N4O2S — CID 135727912
N-[(E)-1-(3-oxo-2-phenyl-5-propyl-1H-pyrazol-4-yl)ethylideneamino]thiophene-2-carboxamide (PubChem CID 135727912) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[(E)-1-(3-oxo-2-phenyl-5-propyl-1H-pyrazol-4-yl)ethylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-1-(3-oxo-2-phenyl-5-propyl-1H-pyrazol-4-yl)ethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135727912 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[(E)-1-(3-oxo-2-phenyl-5-propyl-1H-pyrazol-4-yl)ethylideneamino]thiophene-2-carboxamide |
| SMILES | CCCc1[nH]n(-c2ccccc2)c(=O)c1/C(C)=N/NC(=O)c1cccs1 |
| InChI | InChI=1S/C19H20N4O2S/c1-3-8-15-17(13(2)20-21-18(24)16-11-7-12-26-16)19(25)23(22-15)14-9-5-4-6-10-14/h4-7,9-12,22H,3,8H2,1-2H3,(H,21,24)/b20-13+ |
| InChIKey | KPDYPXPKRYMVNG-DEDYPNTBSA-N |
| XLogP | 3.33 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|