C24H28N4O4 — CID 136762055
N-[1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide (PubChem CID 136762055) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide.
| Compound Name | N-[1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 136762055 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[1-[2,5-bis(4-methoxyphenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-3-methylbutanamide |
| SMILES | COc1ccc(-c2[nH]n(-c3ccc(OC)cc3)c(=O)c2C(C)=NNC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-15(2)14-21(29)26-25-16(3)22-23(17-6-10-19(31-4)11-7-17)27-28(24(22)30)18-8-12-20(32-5)13-9-18/h6-13,15,27H,14H2,1-5H3,(H,26,29) |
| InChIKey | XHXDDYQBLIYNRW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|