C28H25N5O5S — CID 135728480
N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 135728480) has the molecular formula C28H25N5O5S and a molecular weight of 543.61 g/mol. Its IUPAC name is N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 135728480 |
| Molecular Formula | C28H25N5O5S |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C(\C)c2c(-c3ccccc3)[nH]n(-c3nc4ccccc4s3)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C28H25N5O5S/c1-16(30-31-26(34)18-14-20(36-2)25(38-4)21(15-18)37-3)23-24(17-10-6-5-7-11-17)32-33(27(23)35)28-29-19-12-8-9-13-22(19)39-28/h5-15,32H,1-4H3,(H,31,34)/b30-16+ |
| InChIKey | VBPNBMLZILYGGP-OKCVXOCRSA-N |
| XLogP | 4.62 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|