C23H22N4O2S — CID 135728447
2-(1,3-benzothiazol-2-yl)-4-[C-methyl-N-(oxolan-2-ylmethyl)carbonimidoyl]-5-phenyl-1H-pyrazol-3-one (PubChem CID 135728447) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-[C-methyl-N-(oxolan-2-ylmethyl)carbonimidoyl]-5-phenyl-1H-pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-[C-methyl-N-(oxolan-2-ylmethyl)carbonimidoyl]-5-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135728447 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-[C-methyl-N-(oxolan-2-ylmethyl)carbonimidoyl]-5-phenyl-1H-pyrazol-3-one |
| SMILES | C/C(=N\CC1CCCO1)c1c(-c2ccccc2)[nH]n(-c2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C23H22N4O2S/c1-15(24-14-17-10-7-13-29-17)20-21(16-8-3-2-4-9-16)26-27(22(20)28)23-25-18-11-5-6-12-19(18)30-23/h2-6,8-9,11-12,17,26H,7,10,13-14H2,1H3/b24-15+ |
| InChIKey | XNMFKFVEXOFCIY-BUVRLJJBSA-N |
| XLogP | 4.43 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|