C26H20N4O3S — CID 135687761
methyl 2-[1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]benzoate (PubChem CID 135687761) has the molecular formula C26H20N4O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is methyl 2-[1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]benzoate.
| Compound Name | methyl 2-[1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]benzoate |
|---|---|
| PubChem CID | 135687761 |
| Molecular Formula | C26H20N4O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | methyl 2-[1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]benzoate |
| SMILES | COC(=O)c1ccccc1/N=C(\C)c1c(-c2ccccc2)[nH]n(-c2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C26H20N4O3S/c1-16(27-19-13-7-6-12-18(19)25(32)33-2)22-23(17-10-4-3-5-11-17)29-30(24(22)31)26-28-20-14-8-9-15-21(20)34-26/h3-15,29H,1-2H3/b27-16+ |
| InChIKey | BMHYYEXHAUSPCI-JVWAILMASA-N |
| XLogP | 5.37 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|