C24H18N6O2S — CID 135728501
N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]pyridine-3-carboxamide (PubChem CID 135728501) has the molecular formula C24H18N6O2S and a molecular weight of 454.52 g/mol. Its IUPAC name is N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135728501 |
| Molecular Formula | C24H18N6O2S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]ethylideneamino]pyridine-3-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cccnc1)c1c(-c2ccccc2)[nH]n(-c2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C24H18N6O2S/c1-15(27-28-22(31)17-10-7-13-25-14-17)20-21(16-8-3-2-4-9-16)29-30(23(20)32)24-26-18-11-5-6-12-19(18)33-24/h2-14,29H,1H3,(H,28,31)/b27-15+ |
| InChIKey | SNVXCTMGCDKQOQ-JFLMPSFJSA-N |
| XLogP | 3.99 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|