C20H14F3N5O2S — CID 3414153
N-[1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]ethylideneamino]benzamide (PubChem CID 3414153) has the molecular formula C20H14F3N5O2S and a molecular weight of 445.43 g/mol. Its IUPAC name is N-[1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]ethylideneamino]benzamide.
| Compound Name | N-[1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3414153 |
| Molecular Formula | C20H14F3N5O2S |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1)c1c(C(F)(F)F)[nH]n(-c2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C20H14F3N5O2S/c1-11(25-26-17(29)12-7-3-2-4-8-12)15-16(20(21,22)23)27-28(18(15)30)19-24-13-9-5-6-10-14(13)31-19/h2-10,27H,1H3,(H,26,29) |
| InChIKey | LLXPZIUWEXISIT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|