C19H13F3N6O2S — CID 135538541
N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]ethylideneamino]pyridine-4-carboxamide (PubChem CID 135538541) has the molecular formula C19H13F3N6O2S and a molecular weight of 446.41 g/mol. Its IUPAC name is N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]ethylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]ethylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135538541 |
| Molecular Formula | C19H13F3N6O2S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-[(E)-1-[2-(1,3-benzothiazol-2-yl)-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]ethylideneamino]pyridine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccncc1)c1c(C(F)(F)F)[nH]n(-c2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C19H13F3N6O2S/c1-10(25-26-16(29)11-6-8-23-9-7-11)14-15(19(20,21)22)27-28(17(14)30)18-24-12-4-2-3-5-13(12)31-18/h2-9,27H,1H3,(H,26,29)/b25-10+ |
| InChIKey | GGWCAUISXWJBKE-KIBLKLHPSA-N |
| XLogP | 3.34 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|