C23H24N4O2S — CID 135728673
2-(1,3-benzothiazol-2-yl)-4-(N-butyl-C-methylcarbonimidoyl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one (PubChem CID 135728673) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-(N-butyl-C-methylcarbonimidoyl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-(N-butyl-C-methylcarbonimidoyl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135728673 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-(N-butyl-C-methylcarbonimidoyl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one |
| SMILES | CCCC/N=C(\C)c1c(-c2ccc(OC)cc2)[nH]n(-c2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C23H24N4O2S/c1-4-5-14-24-15(2)20-21(16-10-12-17(29-3)13-11-16)26-27(22(20)28)23-25-18-8-6-7-9-19(18)30-23/h6-13,26H,4-5,14H2,1-3H3/b24-15+ |
| InChIKey | BKHWEOJYKSCNIY-BUVRLJJBSA-N |
| XLogP | 5.06 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|