C26H26N6O2S2 — CID 135728810
2-(1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-4-[C-methyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbonimidoyl]-1H-pyrazol-3-one (PubChem CID 135728810) has the molecular formula C26H26N6O2S2 and a molecular weight of 518.67 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-4-[C-methyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbonimidoyl]-1H-pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-4-[C-methyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbonimidoyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135728810 |
| Molecular Formula | C26H26N6O2S2 |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-4-[C-methyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbonimidoyl]-1H-pyrazol-3-one |
| SMILES | COc1ccc(-c2[nH]n(-c3nc4ccccc4s3)c(=O)c2/C(C)=N/CCSCc2nc[nH]c2C)cc1 |
| InChI | InChI=1S/C26H26N6O2S2/c1-16-21(29-15-28-16)14-35-13-12-27-17(2)23-24(18-8-10-19(34-3)11-9-18)31-32(25(23)33)26-30-20-6-4-5-7-22(20)36-26/h4-11,15,31H,12-14H2,1-3H3,(H,28,29)/b27-17+ |
| InChIKey | UIOKRRHNDRLIJA-WPWMEQJKSA-N |
| XLogP | 5.22 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|